QUINMERAC
Catalog No: FT-0642179
CAS No: 90717-03-6
- Chemical Name: QUINMERAC
- Molecular Formula: C11H8ClNO2
- Molecular Weight: 221.64
- InChI Key: ALZOLUNSQWINIR-UHFFFAOYSA-N
- InChI: InChI=1S/C11H8ClNO2/c1-6-4-7-2-3-8(12)9(11(14)15)10(7)13-5-6/h2-5H,1H3,(H,14,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 244ºC |
|---|---|
| CAS: | 90717-03-6 |
| MF: | C11H8ClNO2 |
| Flash_Point: | 205.4ºC |
| Product_Name: | quinmerac |
| Density: | 1.406g/cm3 |
| FW: | 221.64000 |
| Bolling_Point: | 416ºC at 760 mmHg |
| Melting_Point: | 244ºC |
|---|---|
| Refractive_Index: | 1.669 |
| MF: | C11H8ClNO2 |
| Flash_Point: | 205.4ºC |
| LogP: | 2.89480 |
| FW: | 221.64000 |
| Density: | 1.406g/cm3 |
| PSA: | 50.19000 |
| Bolling_Point: | 416ºC at 760 mmHg |
| Exact_Mass: | 221.02400 |
| RTECS: | VB1981800 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | T: Toxic; |
| HS_Code: | 2933499013 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)