1,5-DIPHENYL-1,3,5-PENTANETRIONE
Catalog No: FT-0633575
CAS No: 1467-40-9
- Chemical Name: 1,5-DIPHENYL-1,3,5-PENTANETRIONE
- Molecular Formula: C17H14O3
- Molecular Weight: 266.29
- InChI Key: MUNGMRPYTCHBFX-UHFFFAOYSA-N
- InChI: InChI=1S/C17H14O3/c18-15(11-16(19)13-7-3-1-4-8-13)12-17(20)14-9-5-2-6-10-14/h1-10H,11-12H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1,5-diphenylpentane-1,3,5-trione |
|---|---|
| Flash_Point: | 182.6ºC |
| Melting_Point: | 107-109ºC |
| FW: | 266.29100 |
| Density: | 1.172g/cm3 |
| CAS: | 1467-40-9 |
| Bolling_Point: | 422.7ºC at 760mmHg |
| MF: | C17H14O3 |
| Density: | 1.172g/cm3 |
|---|---|
| LogP: | 3.10150 |
| Flash_Point: | 182.6ºC |
| Melting_Point: | 107-109ºC |
| FW: | 266.29100 |
| PSA: | 51.21000 |
| Exact_Mass: | 266.09400 |
| MF: | C17H14O3 |
| Bolling_Point: | 422.7ºC at 760mmHg |
| Vapor_Pressure: | 9.37E-08mmHg at 25°C |
| Refractive_Index: | 1.574 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2914399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)