BENZO(K)FLUORANTHENE
Catalog No: FT-0631871
CAS No: 207-08-9
- Molecular Formula: 252.3
- Formula Weight: C20H12
- Inchl Key: HAXBIWFMXWRORI-UHFFFAOYSA-N
- Inchl: InChI=1S/C20H12/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1/h1-12H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 480.0±0.0 °C at 760 mmHg |
|---|---|
| CAS: | 207-08-9 |
| MF: | C20H12 |
| Melting_Point: | 215-217 °C(lit.) |
| Symbol: | Danger |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 252.309 |
| Product_Name: | BENZO(K)FLUORANTHENE |
| Flash_Point: | 228.6±13.7 °C |
| Bolling_Point: | 480.0±0.0 °C at 760 mmHg |
|---|---|
| LogP: | 6.40 |
| More_Info: | ['1. Appearance 淡Yellow 针状结晶。 ', '2. Density（g/mL,25/4℃）Unknow ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）217 ', '5. Boiling point（ºC,Atmospheric pressure）480 ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive indexUnknow ', '8. Flash point（ºC）Unknow ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Soluble in Ethanol 苯and 乙酸。'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :0 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :N/A ', '6. TPSA 0 ', '7. Heavy Atom Count :20 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :338 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 215-217 °C(lit.) |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 252.093903 |
| MF: | C20H12 |
| Density: | 1.3±0.1 g/cm3 |
| Refractive_Index: | 1.887 |
| Flash_Point: | 228.6±13.7 °C |
| Molecular_Structure: | ['1 . Molar refractive index 9030 ', '2 . Molar volume 1960 ', '3 . Parachor （902K）5535 ', '4 . Surface tension 634 ', '5 . Dielectric constant （F/m）351 ', '6 . Polarizability 3580'] |
| FW: | 252.309 |
| Safety_Statements: | H350-H410 |
|---|---|
| HS_Code: | 2902909090 |
| RIDADR: | UN 2811 6.1/PG 3 |
| Hazard_Codes: | T,N,Xn,F |
| RTECS: | DF6350000 |
| Supplementary_Hazard_Statement: | Repeated exposure may cause skin dryness or cracking. |
| Target_Organ: | Blood, Central nervous system, Liver |
| Risk_Statements(EU): | R45 |
| WGK_Germany: | 3 |
| Symbol: | Danger |
| Personal_Protective_Equipment: | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard_Class: | 6.1(b) |
| Packing_Group: | III |
| Warning_Statement: | P201-P273-P308 + P313-P501 |
