Dimethylthiocarbamoyl chloride
Catalog No: FT-0629526
CAS No: 16420-13-6
- Molecular Formula: 123.61
- Formula Weight: C3H6ClNS
- Inchl Key: PHWISQNXPLXQRU-UHFFFAOYSA-N
- Inchl: InChI=1S/C3H6ClNS/c1-5(2)3(4)6/h1-2H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Dimethylcarbamothioic chloride |
|---|---|
| Bolling_Point: | 287.4±9.0 °C at 760 mmHg |
| MF: | C3H6ClNS |
| Symbol: | GHS05, GHS07 |
| Melting_Point: | 42-44 ºC |
| CAS: | 16420-13-6 |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 123.604 |
| Flash_Point: | 98 ºC |
| MF: | C3H6ClNS |
|---|---|
| Water_Solubility: | 起反应 |
| Bolling_Point: | 287.4±9.0 °C at 760 mmHg |
| Exact_Mass: | 122.990944 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）0842g/mLat 25°C3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）−30°C(lit)5. Boiling point（ºC,Atmospheric pressure）174°C(lit)6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive indexn 20/D 1407(lit)8. Flash point（ºC）115°F9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Melting_Point: | 42-44 ºC |
| PSA: | 35.33000 |
| Flash_Point: | 98 ºC |
| Computational_Chemistry: | ['1. XlogP :14 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :N/A ', '6. TPSA 353 ', '7. Heavy Atom Count :6 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :618 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Density: | 1.2±0.1 g/cm3 |
| Molecular_Structure: | ['1 . Molar refractive index 3180 ', '2 . Molar volume （m3/mol）1016 ', '3 . Parachor （902K）2621 ', '<span lang="EN-US" style="FONT-SIZE: 9pt'] |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| FW: | 123.604 |
| LogP: | 0.85 |
| Refractive_Index: | 1.538 |
| Risk_Statements(EU): | R14;R29;R34 |
|---|---|
| Hazard_Codes: | C:Corrosive; |
| HS_Code: | 2930909090 |
| Packing_Group: | III |
| WGK_Germany: | 2 |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H302-H314-H317 |
| Symbol: | GHS05, GHS07 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard_Class: | 8 |
| RIDADR: | UN 3261 8/PG 2 |
Related Products
(5E)-5-(3-Ethoxy-2-hydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one
