ADRENOCHROME
Catalog No: FT-0621930
CAS No: 54-06-8
- Chemical Name: ADRENOCHROME
- Molecular Formula: C9H9NO3
- Molecular Weight: 179.17
- InChI Key: RPHLQSHHTJORHI-UHFFFAOYSA-N
- InChI: InChI=1S/C9H9NO3/c1-10-4-9(13)5-2-7(11)8(12)3-6(5)10/h2-3,9,13H,4H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 115-120ºC |
|---|---|
| CAS: | 54-06-8 |
| MF: | C9H9NO3 |
| Flash_Point: | 180.7ºC |
| Product_Name: | 3-Hydroxy-1-methyl-5,6-indolinedione |
| Density: | 1.42g/cm3 |
| FW: | 179.17300 |
| Bolling_Point: | 375.1ºC at 760 mmHg |
| Melting_Point: | 115-120ºC |
|---|---|
| Refractive_Index: | 1.63 |
| MF: | C9H9NO3 |
| Flash_Point: | 180.7ºC |
| FW: | 179.17300 |
| Density: | 1.42g/cm3 |
| PSA: | 57.61000 |
| Bolling_Point: | 375.1ºC at 760 mmHg |
| Exact_Mass: | 179.05800 |
| Risk_Statements(EU): | 36/37/38 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RTECS: | NM1925000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)