5-METHYL-2-N-PENTYLPHENOL
Catalog No: FT-0620948
CAS No: 1300-94-3
- Chemical Name: 5-METHYL-2-N-PENTYLPHENOL
- Molecular Formula: C12H18O
- Molecular Weight: 178.27
- InChI Key: CKGWFZQGEQJZIL-UHFFFAOYSA-N
- InChI: InChI=1S/C12H18O/c1-3-4-5-6-11-8-7-10(2)9-12(11)13/h7-9,13H,3-6H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 1300-94-3 |
| Flash_Point: | 125.3ºC |
| Product_Name: | amylmetacresol |
| Bolling_Point: | 273.2ºC at 760 mmHg |
| FW: | 178.27100 |
| Melting_Point: | N/A |
| MF: | C12H18O |
| Density: | 0.955g/cm3 |
| Refractive_Index: | 1.516 |
|---|---|
| Vapor_Pressure: | 0.00348mmHg at 25°C |
| MF: | C12H18O |
| Flash_Point: | 125.3ºC |
| LogP: | 3.43330 |
| FW: | 178.27100 |
| Density: | 0.955g/cm3 |
| PSA: | 20.23000 |
| Bolling_Point: | 273.2ºC at 760 mmHg |
| Exact_Mass: | 178.13600 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2907199090 |
| RTECS: | GP3100000 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P301 + P312 + P330 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)