4-DI-2-ASP
Catalog No: FT-0616597
CAS No: 105802-46-8
- Chemical Name: 4-DI-2-ASP
- Molecular Formula: C18H23IN2
- Molecular Weight: 394.3
- InChI Key: WIPKWLIHFGTFQV-UHFFFAOYSA-M
- InChI: InChI=1S/C18H23N2.HI/c1-4-20(5-2)18-10-8-16(9-11-18)6-7-17-12-14-19(3)15-13-17;/h6-15H,4-5H2,1-3H3;1H/q+1;/p-1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 105802-46-8 |
| Flash_Point: | N/A |
| Product_Name: | 4-(4-diethylaminostyryl)-1-methylpyridinium iodide |
| Bolling_Point: | N/A |
| FW: | 394.29300 |
| Melting_Point: | 214-216ºC(lit.) |
| MF: | C18H23IN2 |
| Density: | N/A |
| Melting_Point: | 214-216ºC(lit.) |
|---|---|
| MF: | C18H23IN2 |
| Exact_Mass: | 394.09100 |
| LogP: | 0.53170 |
| FW: | 394.29300 |
| PSA: | 7.12000 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933399090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)