4-(2-CARBOXYVINYL)BENZENEBORONIC ACID
Catalog No: FT-0616521
CAS No: 159896-15-8
- Molecular Formula: 191.98
- Formula Weight: C9H9BO4
- Inchl Key: IEMLKNHGGSYOMP-ZZXKWVIFSA-N
- Inchl: InChI=1S/C9H9BO4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-6,13-14H,(H,11,12)/b6-3+
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 191.97600 |
| Density: | 1.33 g/cm3 |
| CAS: | 159896-15-8 |
| Bolling_Point: | 439ºC at 760 mmHg |
| Product_Name: | (E)-3-(4-Boronophenyl)acrylic acid |
| Melting_Point: | 222-224ºC |
| Flash_Point: | 219.3ºC |
| MF: | C9H9BO4 |
| Density: | 1.33 g/cm3 |
|---|---|
| Flash_Point: | 219.3ºC |
| Melting_Point: | 222-224ºC |
| FW: | 191.97600 |
| PSA: | 77.76000 |
| MF: | C9H9BO4 |
| Bolling_Point: | 439ºC at 760 mmHg |
| Exact_Mass: | 192.05900 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | H302 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)