![3-NITROBENZO[B]FURAN-5-OL (CAS: 126318-27-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0616239.png "3-NITROBENZO[B]FURAN-5-OL chemical structure")
3-NITROBENZO[B]FURAN-5-OL
Catalog No: FT-0616239
CAS No: 126318-27-2
- Chemical Name: 3-NITROBENZO[B]FURAN-5-OL
- Molecular Formula: C8H5NO4
- Molecular Weight: 179.13
- InChI Key: ZQPBTBWGCWHIGU-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5NO4/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-4,10H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-nitro-1-benzofuran-5-ol |
|---|---|
| Flash_Point: | 168.1ºC |
| Melting_Point: | 164ºC |
| FW: | 179.13000 |
| Density: | 1.536g/cm3 |
| CAS: | 126318-27-2 |
| Bolling_Point: | 354.3ºC at 760 mmHg |
| MF: | C8H5NO4 |
| Density: | 1.536g/cm3 |
|---|---|
| LogP: | 2.56980 |
| Flash_Point: | 168.1ºC |
| Melting_Point: | 164ºC |
| FW: | 179.13000 |
| PSA: | 79.19000 |
| Exact_Mass: | 179.02200 |
| MF: | C8H5NO4 |
| Bolling_Point: | 354.3ºC at 760 mmHg |
| Vapor_Pressure: | 1.65E-05mmHg at 25°C |
| Refractive_Index: | 1.694 |
| Hazard_Codes: | Xi |
|---|---|
| HS_Code: | 2932999099 |
| Safety_Statements: | S24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)