3-Furoyl chloride
Catalog No: FT-0615766
CAS No: 26214-65-3
- Molecular Formula: 130.53
- Formula Weight: C5H3ClO2
- Inchl Key: BTUIFMCWPFMNRG-UHFFFAOYSA-N
- Inchl: InChI=1S/C5H3ClO2/c6-5(7)4-1-2-8-3-4/h1-3H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05 |
|---|---|
| CAS: | 26214-65-3 |
| Flash_Point: | 46.1ºC |
| Product_Name: | 3-Furoyl chloride |
| Bolling_Point: | 62-64ºC (15 mmHg) |
| FW: | 130.52900 |
| Melting_Point: | N/A |
| MF: | C5H3ClO2 |
| Density: | 1.323g/cm3 |
| Refractive_Index: | 1.495 |
|---|---|
| Vapor_Pressure: | 3.46mmHg at 25°C |
| MF: | C5H3ClO2 |
| Flash_Point: | 46.1ºC |
| LogP: | 1.65860 |
| FW: | 130.52900 |
| Density: | 1.323g/cm3 |
| PSA: | 30.21000 |
| Bolling_Point: | 62-64ºC (15 mmHg) |
| Exact_Mass: | 129.98200 |
| Symbol: | GHS05 |
|---|---|
| Supplementary_Hazard_Statement: | Contact with water liberates toxic gas., Reacts violently with water. |
| Risk_Statements(EU): | R14;R29;R34 |
| HS_Code: | 2932190090 |
| RIDADR: | UN 3261 |
| Hazard_Codes: | C: Corrosive; |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H314 |
