3-Bromopropionyl chloride
Catalog No: FT-0615246
CAS No: 15486-96-1
- Molecular Formula: 171.42
- Formula Weight: C3H4BrClO
- Inchl Key: IHBVNSPHKMCPST-UHFFFAOYSA-N
- Inchl: InChI=1S/C3H4BrClO/c4-2-1-3(5)6/h1-2H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 15486-96-1 |
| Flash_Point: | 55.4±22.6 °C |
| Product_Name: | 3-Bromopropanoyl chloride |
| Bolling_Point: | 156.7±0.0 °C at 760 mmHg |
| FW: | 171.420 |
| Melting_Point: | N/A |
| MF: | C3H4BrClO |
| Density: | 1.7±0.1 g/cm3 |
| Refractive_Index: | 1.484 |
|---|---|
| Vapor_Pressure: | 2.9±0.3 mmHg at 25°C |
| Flash_Point: | 55.4±22.6 °C |
| LogP: | 1.43 |
| Bolling_Point: | 156.7±0.0 °C at 760 mmHg |
| Water_Solubility: | REACTS |
| FW: | 171.420 |
| PSA: | 17.07000 |
| Computational_Chemistry: | ['1. XlogP :15 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA 171 ', '7. Heavy Atom Count :6 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :548 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| MF: | C3H4BrClO |
| Exact_Mass: | 169.913391 |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 2855 ', '2 . Molar volume （m3/mol）997 ', '3 . Parachor （902K）2471 ', '4 . Surface tension 377 ', '5 . Polarizability 1132'] |
| Density: | 1.7±0.1 g/cm3 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）1701 ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）Unknow ', '5. Boiling point（ºC,Atmospheric pressure）55-57 ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive index149 ', '8. Flash point（ºC）175 ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Symbol: | GHS05, GHS07 |
|---|---|
| RIDADR: | UN 3265 8/PG 2 |
| HS_Code: | 2915900090 |
| Packing_Group: | III |
| Hazard_Class: | 8 |
| Risk_Statements(EU): | R34 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard_Codes: | C:Corrosive; |
| Warning_Statement: | P261-P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H314-H335 |
