3-Aminothiophenol
Catalog No: FT-0614900
CAS No: 22948-02-3
- Chemical Name: 3-Aminothiophenol
- Molecular Formula: C6H7NS
- Molecular Weight: 125.19
- InChI Key: KFFUEVDMVNIOHA-UHFFFAOYSA-N
- InChI: InChI=1S/C6H7NS/c7-5-2-1-3-6(8)4-5/h1-4,8H,7H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 125.191 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 22948-02-3 |
| Bolling_Point: | 265.2±23.0 °C at 760 mmHg |
| Product_Name: | 3-Aminothiophenol |
| Melting_Point: | 97ºC |
| Flash_Point: | 79.4±0.0 °C |
| MF: | C6H7NS |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 3866 ', '2 . Molar volume 1043 ', '3 . Parachor (902K)2816 ', '4 表面张力(dyne/cm)530 ', '5 . Polarizability (10-24cm3)1532'] |
|---|---|
| Flash_Point: | 79.4±0.0 °C |
| Refractive_Index: | 1.663 |
| FW: | 125.191 |
| Density: | 1.2±0.1 g/cm3 |
| Bolling_Point: | 265.2±23.0 °C at 760 mmHg |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :9 ', '6. TPSA 27 ', '7. Heavy Atom Count :8 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :749 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| LogP: | 1.27 |
| Melting_Point: | 97ºC |
| PSA: | 64.82000 |
| MF: | C6H7NS |
| More_Info: | ['1. Appearance 淡Yellow to 黄褐色Liquid ', '2. Density(g/mL,25/4℃)1179 ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)97 ', '5. Boiling point(ºC,Atmospheric pressure)80 ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive index1656 ', '8. Flash point(ºC)175°F ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Exact_Mass: | 125.029922 |
| Hazard_Codes: | C:Corrosive; |
|---|---|
| Symbol: | Danger |
| Packing_Group: | III |
| Hazard_Class: | 8 |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| HS_Code: | 2930909090 |
| Personal_Protective_Equipment: | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Risk_Statements(EU): | R34 |
| Safety_Statements: | S26-S27-S36/37/39-S45-S25 |
| RIDADR: | UN 3267 8/PG 2 |
| WGK_Germany: | 3 |