3-(4-FLUOROPHENYL)-5-METHYL-4-ISOXAZOLECARBOXYLIC ACID
Catalog No: FT-0613668
CAS No: 1736-21-6
- Molecular Formula: 221.18
- Formula Weight: C11H8FNO3
- Inchl Key: PDEGBONVUJDOFN-UHFFFAOYSA-N
- Inchl: InChI=1S/C11H8FNO3/c1-6-9(11(14)15)10(13-16-6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H,14,15)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-(4-Fluorophenyl)-5-methylisoxazole-4-carboxylic acid |
|---|---|
| Flash_Point: | 172.5ºC |
| Melting_Point: | 198-202ºC |
| FW: | 221.18500 |
| Density: | 1.35g/cm3 |
| CAS: | 1736-21-6 |
| Bolling_Point: | 361.6ºC at 760mmHg |
| MF: | C11H8FNO3 |
| Density: | 1.35g/cm3 |
|---|---|
| LogP: | 2.48730 |
| Flash_Point: | 172.5ºC |
| Melting_Point: | 198-202ºC |
| FW: | 221.18500 |
| PSA: | 63.33000 |
| Exact_Mass: | 221.04900 |
| MF: | C11H8FNO3 |
| Bolling_Point: | 361.6ºC at 760mmHg |
| Vapor_Pressure: | 7.36E-06mmHg at 25°C |
| Refractive_Index: | 1.56 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard_Codes: | Xi:Irritant; |
| Risk_Statements(EU): | 36/37/38 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)