2-Ethyl-3-methylpyrazine
Catalog No: FT-0612243
CAS No: 15707-23-0
- Molecular Formula: 122.17
- Formula Weight: C7H10N2
- Inchl Key: LNIMMWYNSBZESE-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H10N2/c1-3-7-6(2)8-4-5-9-7/h4-5H,3H2,1-2H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS02, GHS07 |
|---|---|
| CAS: | 15707-23-0 |
| Flash_Point: | 57.2±0.0 °C |
| Product_Name: | 2-Ethyl-3-methylpyrazine |
| Bolling_Point: | 173.5±35.0 °C at 760 mmHg |
| FW: | 122.168 |
| Melting_Point: | N/A |
| MF: | C7H10N2 |
| Density: | 1.0±0.1 g/cm3 |
| Refractive_Index: | 1.501 |
|---|---|
| Vapor_Pressure: | 1.7±0.3 mmHg at 25°C |
| Flash_Point: | 57.2±0.0 °C |
| LogP: | 1.17 |
| Bolling_Point: | 173.5±35.0 °C at 760 mmHg |
| Water_Solubility: | sparingly soluble |
| PSA: | 25.78000 |
| Molecular_Structure: | ['1 . Molar refractive index 3680 ', '2 . Molar volume 1249 ', '3 . Parachor （902K）3098 ', '4 . Surface tension 377 ', '5 . Polarizability 1459'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :2 ', '6. TPSA 258 ', '7. Heavy Atom Count :9 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :83 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| MF: | C7H10N2 |
| Exact_Mass: | 122.084396 |
| FW: | 122.168 |
| Density: | 1.0±0.1 g/cm3 |
| More_Info: | ['1. Appearance Colourless to Yellow 油状Liquid 。 ', '2相对. Density（m/L，2/24℃）15023 ', '3. Boiling point（133KPa，℃）57 ', ' （213KPa，℃）69-70 ', '4. Solubility Soluble in Water and 有机溶剂。'] |
| Symbol: | GHS02, GHS07 |
|---|---|
| RIDADR: | UN 1993 3/PG 3 |
| HS_Code: | 2933990090 |
| Packing_Group: | III |
| Hazard_Class: | 3 |
| Risk_Statements(EU): | R22 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RTECS: | UQ3335000 |
| Hazard_Codes: | Xn:Harmful |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H226-H302-H315-H319-H335 |
