2-Cyano-phenothiazine
Catalog No: FT-0612115
CAS No: 38642-74-9
- Molecular Formula: 224.28
- Formula Weight: C13H8N2S
- Inchl Key: XZSIGWOVDPSPMG-UHFFFAOYSA-N
- Inchl: InChI=1S/C13H8N2S/c14-8-9-5-6-13-11(7-9)15-10-3-1-2-4-12(10)16-13/h1-7,15H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 4°C |
|---|---|
| CAS: | 38642-74-9 |
| MF: | C13H8N2S |
| Flash_Point: | 212.4±25.7 °C |
| Product_Name: | 2-Cyano-phenothiazine |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 224.281 |
| Bolling_Point: | 427.6±34.0 °C at 760 mmHg |
| Refractive_Index: | 1.743 |
|---|---|
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Flash_Point: | 212.4±25.7 °C |
| LogP: | 4.26 |
| Bolling_Point: | 427.6±34.0 °C at 760 mmHg |
| FW: | 224.281 |
| PSA: | 61.12000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :N/A ', '6. TPSA 611 ', '7. Heavy Atom Count :16 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :308 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 4°C |
| MF: | C13H8N2S |
| Exact_Mass: | 224.040817 |
| Density: | 1.4±0.1 g/cm3 |
| Safety_Statements: | S26-S36/37/39 |
|---|---|
| Hazard_Codes: | Xi |
| HS_Code: | 2934300000 |
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . |
