2-Chloro-6-methoxyisonicotinic acid
Catalog No: FT-0611871
CAS No: 15855-06-8
- Chemical Name: 2-Chloro-6-methoxyisonicotinic acid
- Molecular Formula: C7H6ClNO3
- Molecular Weight: 187.58
- InChI Key: PJQBTHQTVJMCFX-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6ClNO3/c1-12-6-3-4(7(10)11)2-5(8)9-6/h2-3H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 187.580 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 15855-06-8 |
| Bolling_Point: | 408.9±40.0 °C at 760 mmHg |
| Product_Name: | 2-Chloro-6-methoxyisonicotinic acid |
| Melting_Point: | 214-216ºC |
| Flash_Point: | 201.1±27.3 °C |
| MF: | C7H6ClNO3 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 2.66 |
| Flash_Point: | 201.1±27.3 °C |
| Melting_Point: | 214-216ºC |
| FW: | 187.580 |
| PSA: | 59.42000 |
| Exact_Mass: | 187.003616 |
| MF: | C7H6ClNO3 |
| Bolling_Point: | 408.9±40.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Refractive_Index: | 1.567 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi:Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S37/39 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)