2-(DIFLUOROMETHOXY)ANILINE
Catalog No: FT-0608776
CAS No: 22236-04-0
- Molecular Formula: 159.13
- Formula Weight: C7H7F2NO
- Inchl Key: CGNAIUUCOVWLLL-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-(Difluoromethoxy)aniline |
|---|---|
| Bolling_Point: | 209.8±30.0 °C at 760 mmHg |
| MF: | C7H7F2NO |
| Symbol: | GHS07 |
| Melting_Point: | N/A |
| CAS: | 22236-04-0 |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 159.133 |
| Flash_Point: | 80.7±24.6 °C |
| MF: | C7H7F2NO |
|---|---|
| Bolling_Point: | 209.8±30.0 °C at 760 mmHg |
| Exact_Mass: | 159.049576 |
| More_Info: | ['1. Appearance Colourless 透明Liquid 。有特征性气味 ', '2. Density（g/mL,25/4℃）1265 ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）Unknow ', '5. Boiling point（ºC,Atmospheric pressure）86 ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive index 15040 ', '8. Flash point（ºC）Unknow ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| PSA: | 35.25000 |
| Flash_Point: | 80.7±24.6 °C |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA 352 ', '7. Heavy Atom Count :11 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :121 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Density: | 1.3±0.1 g/cm3 |
| Molecular_Structure: | ['1 . Molar refractive index 3745 ', '2 . Molar volume (cm3/mol)1269 ', '3 . Parachor (902K)3061 ', '4 表面张力(dyne/cm)337 ', '5 . Polarizability (10-24cm3)1484'] |
| Vapor_Pressure: | 0.2±0.4 mmHg at 25°C |
| FW: | 159.133 |
| LogP: | 1.27 |
| Refractive_Index: | 1.502 |
| Risk_Statements(EU): | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . |
|---|---|
| Hazard_Codes: | Xn,T |
| HS_Code: | 2922299090 |
| Packing_Group: | III |
| WGK_Germany: | 3 |
| Warning_Statement: | P280 |
| Safety_Statements: | H302-H312-H332 |
| Symbol: | GHS07 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard_Class: | 6.1 |
| RIDADR: | 2811 |
