2-(4-PYRIDYL)THIAZOLE-4-CARBOXYLIC ACID
Catalog No: FT-0608692
CAS No: 21278-86-4
- Molecular Formula: 205.22
- Formula Weight: C9H5N2O2S-
- Inchl Key: COOQMBOJAAZEIR-UHFFFAOYSA-M
- Inchl: InChI=1S/C9H6N2O2S/c12-9(13)7-5-14-8(11-7)6-1-3-10-4-2-6/h1-5H,(H,12,13)/p-1
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 469.3±51.0 °C at 760 mmHg |
|---|---|
| Symbol: | GHS07 |
| MF: | C9H6N2O2S |
| Melting_Point: | >300 °C(lit.) |
| Flash_Point: | 237.6±30.4 °C |
| FW: | 206.221 |
| Product_Name: | 2-pyridin-4-yl-1,3-thiazole-4-carboxylic acid |
| CAS: | 21278-86-4 |
| Density: | 1.4±0.1 g/cm3 |
| PSA: | 91.32000 |
|---|---|
| Bolling_Point: | 469.3±51.0 °C at 760 mmHg |
| Molecular_Structure: | ['1 . Molar refractive index 5234 ', '2 . Molar volume (m3/mol)1431 ', '3 . Parachor (902K)4142 ', '4 表面张力(dyne/cm)700 ', '5 . Polarizability (10-24cm3)2074'] |
| LogP: | 1.65 |
| More_Info: | ['1. Appearance Solid ', '2. Density（g/mL,25/4℃）Unknow ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）>300 ', '5. Boiling point（ºC,Atmospheric pressure）Unknow ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive indexUnknow ', '8. Flash point（ºC）Unknow ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| MF: | C9H6N2O2S |
| Computational_Chemistry: | ['1. XlogP :21 ', '2. Hydrogen Bond Donor Count 0 ', '3. Hydrogen Bond Acceptor Count 4 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count ', '6. TPSA :659 ', '7. Heavy Atom Count 14 ', '8. Topological Polar Surface Area 0 ', '9. Complexity 213 ', '10. Isotope Atom Count 0 ', '11. Defined Atom Stereocenter Count 0 ', '12. Undefined Atom Stereocenter Count 0 ', '13. Defined Bond Stereocenter Count 0 ', '14. Undefined Bond Stereocenter Count 0 ', '15. Covalently-Bonded Unit Count 1'] |
| Melting_Point: | >300 °C(lit.) |
| Refractive_Index: | 1.652 |
| Flash_Point: | 237.6±30.4 °C |
| FW: | 206.221 |
| Exact_Mass: | 206.014999 |
| Vapor_Pressure: | 0.0±1.2 mmHg at 25°C |
| Density: | 1.4±0.1 g/cm3 |
| Safety_Statements: | S26-S36 |
|---|---|
| Warning_Statement: | P301 + P312 + P330-P305 + P351 + P338 |
| Hazard_Codes: | Xi:Irritant; |
| Symbol: | GHS07 |
| WGK_Germany: | 3 |
| HS_Code: | 2934100090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Risk_Statements(EU): | R36/37/38 |
| RIDADR: | NONH for all modes of transport |
