(2RS)-2-[4-(2-METHYLPROPYL)PHENYL]PROPANAMIDE
Catalog No: FT-0608652
CAS No: 59512-17-3
- Chemical Name: (2RS)-2-[4-(2-METHYLPROPYL)PHENYL]PROPANAMIDE
- Molecular Formula: C13H19NO
- Molecular Weight: 205.30
- InChI Key: REUQKCDCQVNKLW-UHFFFAOYSA-N
- InChI: InChI=1S/C13H19NO/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H2,14,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 59512-17-3 |
| Flash_Point: | 169.1±22.1 °C |
| Product_Name: | (2RS)-2-[4-(2-Methylpropyl)Phenyl]Propanamide |
| Bolling_Point: | 356.1±21.0 °C at 760 mmHg |
| FW: | 205.296 |
| Melting_Point: | 110-114ºC |
| MF: | C13H19NO |
| Density: | 1.0±0.1 g/cm3 |
| Melting_Point: | 110-114ºC |
|---|---|
| Refractive_Index: | 1.520 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| MF: | C13H19NO |
| Flash_Point: | 169.1±22.1 °C |
| LogP: | 2.67 |
| FW: | 205.296 |
| Density: | 1.0±0.1 g/cm3 |
| PSA: | 43.09000 |
| Bolling_Point: | 356.1±21.0 °C at 760 mmHg |
| Exact_Mass: | 205.146667 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)