1-ALLYL-3,7-DIMETHYL-8-PHENYLXANTHINE
Catalog No: FT-0607305
CAS No: 149981-23-7
- Molecular Formula: 296.32
- Formula Weight: C16H16N4O2
- Inchl Key: DKISSNPEWQAXRA-UHFFFAOYSA-N
- Inchl: InChI=1S/C16H16N4O2/c1-4-10-20-15(21)12-14(19(3)16(20)22)17-13(18(12)2)11-8-6-5-7-9-11/h4-9H,1,10H2,2-3H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3,7-dimethyl-8-phenyl-1-prop-2-enylpurine-2,6-dione |
|---|---|
| Flash_Point: | 257.8ºC |
| Melting_Point: | 173-174ºC |
| FW: | 296.32400 |
| Density: | 1.26g/cm3 |
| CAS: | 149981-23-7 |
| Bolling_Point: | 502.7ºC at 760 mmHg |
| MF: | C16H16N4O2 |
| Density: | 1.26g/cm3 |
|---|---|
| LogP: | 1.28670 |
| Flash_Point: | 257.8ºC |
| Melting_Point: | 173-174ºC |
| FW: | 296.32400 |
| PSA: | 61.82000 |
| Exact_Mass: | 296.12700 |
| MF: | C16H16N4O2 |
| Bolling_Point: | 502.7ºC at 760 mmHg |
| Vapor_Pressure: | 3.1E-10mmHg at 25°C |
| Refractive_Index: | 1.644 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)