10-UNDECYNOIC ACID
Catalog No: FT-0607205
CAS No: 2777-65-3
- Chemical Name: 10-UNDECYNOIC ACID
- Molecular Formula: C11H18O2
- Molecular Weight: 182.26
- InChI Key: OAOUTNMJEFWJPO-UHFFFAOYSA-N
- InChI: InChI=1S/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 182.259 |
|---|---|
| CAS: | 2777-65-3 |
| Flash_Point: | 142.9±17.3 °C |
| MF: | C11H18O2 |
| Symbol: | Warning |
| Bolling_Point: | 297.7±23.0 °C at 760 mmHg |
| Melting_Point: | 40-42 °C(lit.) |
| Product_Name: | 10-Undecynoic acid |
| Density: | 1.0±0.1 g/cm3 |
| FW: | 182.259 |
|---|---|
| MF: | C11H18O2 |
| Flash_Point: | 142.9±17.3 °C |
| Refractive_Index: | 1.468 |
| Vapor_Pressure: | 0.0±1.3 mmHg at 25°C |
| Bolling_Point: | 297.7±23.0 °C at 760 mmHg |
| Exact_Mass: | 182.130676 |
| PSA: | 37.30000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :8 ', '5. Isotope Atom Count :N/A ', '6. TPSA 373 ', '7. Heavy Atom Count :13 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :176 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Molecular_Structure: | ['1. Molar refractive index 5240 ', '2. Molar volume 1885 ', '3. Parachor (902K)4705 ', '4. Surface tension 388 ', '5. Polarizability 2077'] |
| LogP: | 3.14 |
| Melting_Point: | 40-42 °C(lit.) |
| Density: | 1.0±0.1 g/cm3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | YQ3683000 |
| HS_Code: | 2916190090 |
| Symbol: | Warning |
| Risk_Statements(EU): | R36/37/38 |
| WGK_Germany: | 3 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)