(R)-3-HYDROXYBUTYRIC ACID
Catalog No: FT-0605155
CAS No: 625-72-9
- Chemical Name: (R)-3-HYDROXYBUTYRIC ACID
- Molecular Formula: C4H8O3
- Molecular Weight: 104.1
- InChI Key: WHBMMWSBFZVSSR-GSVOUGTGSA-N
- InChI: InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (R)-3-hydroxybutyric acid |
|---|---|
| Bolling_Point: | 269.2ºC at 760 mmHg |
| Density: | 1.195 g/cm3 |
| MF: | C4H8O3 |
| CAS: | 625-72-9 |
| Melting_Point: | 49-50ºC(lit.) |
| Flash_Point: | 112ºC |
| FW: | 104.10500 |
| Exact_Mass: | 104.04700 |
|---|---|
| Refractive_Index: | 1.455 |
| MF: | C4H8O3 |
| Bolling_Point: | 269.2ºC at 760 mmHg |
| Density: | 1.195 g/cm3 |
| FW: | 104.10500 |
| Melting_Point: | 49-50ºC(lit.) |
| Flash_Point: | 112ºC |
| PSA: | 57.53000 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| HS_Code: | 2918199090 |
| Safety_Statements: | 26-36 |
| Hazard_Codes: | Xi: Irritant; |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)