Methyl (R)-(-)-3-hydroxybutyrate
Catalog No: FT-0605058
CAS No: 3976-69-0
- Chemical Name: Methyl (R)-(-)-3-hydroxybutyrate
- Molecular Formula: C5H10O3
- Molecular Weight: 118.13
- InChI Key: LDLDJEAVRNAEBW-SCSAIBSYSA-N
- InChI: InChI=1S/C5H10O3/c1-4(6)3-5(7)8-2/h4,6H,3H2,1-2H3/t4-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 118.131 |
|---|---|
| CAS: | 3976-69-0 |
| Flash_Point: | 71.7±0.0 °C |
| MF: | C5H10O3 |
| Symbol: | Warning |
| Bolling_Point: | 161.9±0.0 °C at 760 mmHg |
| Melting_Point: | N/A |
| Product_Name: | Methyl (R)-(-)-3-hydroxybutyrate |
| Density: | 1.055 |
| FW: | 118.131 |
|---|---|
| MF: | C5H10O3 |
| Refractive_Index: | 1.420 |
| Bolling_Point: | 161.9±0.0 °C at 760 mmHg |
| Exact_Mass: | 118.062996 |
| PSA: | 46.53000 |
| Computational_Chemistry: | ['1. XlogP :-02 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :3 ', '5. Isotope Atom Count :N/A ', '6. TPSA 465 ', '7. Heavy Atom Count :8 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :797 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :1 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Vapor_Pressure: | 0.8±0.6 mmHg at 25°C |
| LogP: | -0.55 |
| Flash_Point: | 71.7±0.0 °C |
| Density: | 1.055 |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Symbol: | GHS07 |
| WGK_Germany: | 3 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| RIDADR: | NA 1993 / PGIII |
| Risk_Statements(EU): | 36/37/38 |
| Hazard_Codes: | Xi |
| HS_Code: | 2918199090 |