(1R,2S)-2-Amino-1,2-diphenylethanol
Catalog No: FT-0604541
CAS No: 23190-16-1
- Chemical Name: (1R,2S)-2-Amino-1,2-diphenylethanol
- Molecular Formula: C14H15NO
- Molecular Weight: 213.27
- InChI Key: GEJJWYZZKKKSEV-UONOGXRCSA-N
- InChI: InChI=1S/C14H15NO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14,16H,15H2/t13-,14+/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 213.275 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 23190-16-1 |
| Bolling_Point: | 374.3±37.0 °C at 760 mmHg |
| Product_Name: | (1R,2S)-2-Amino-1,2-diphenylethanol |
| Melting_Point: | 142-144 °C(lit.) |
| Flash_Point: | 180.2±26.5 °C |
| MF: | C14H15NO |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 6536 ', '2 . Molar volume 1856 ', '3 . Parachor (902K)4991 ', '4 表面张力(dyne/cm)522 ', '5 . Polarizability (10-24cm3)2591'] |
|---|---|
| Flash_Point: | 180.2±26.5 °C |
| Refractive_Index: | 1.622 |
| FW: | 213.275 |
| Density: | 1.1±0.1 g/cm3 |
| Bolling_Point: | 374.3±37.0 °C at 760 mmHg |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :3 ', '5. Isotope Atom Count :N/A ', '6. TPSA 462 ', '7. Heavy Atom Count :16 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :195 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :2 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| LogP: | 2.28 |
| Melting_Point: | 142-144 °C(lit.) |
| PSA: | 46.25000 |
| MF: | C14H15NO |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)142-144 ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC)Unknow ', '9. Specific rotation(º) (º, C=6, EtOH)-7 º ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Exact_Mass: | 213.115356 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi:Irritant |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2942000000 |
| WGK_Germany: | 3 |