2-(4-Acetyl-piperazin-1-yl)-6-chloroaniline
Catalog No: FT-0604249
CAS No: 875576-30-0
- Chemical Name: 2-(4-Acetyl-piperazin-1-yl)-6-chloroaniline
- Molecular Formula: C12H16ClN3O
- Molecular Weight: 253.73
- InChI Key: ONNBEKXYXSBGTL-UHFFFAOYSA-N
- InChI: InChI=1S/C12H16ClN3O/c1-9(17)15-5-7-16(8-6-15)11-4-2-3-10(13)12(11)14/h2-4H,5-8,14H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-[4-(2-amino-3-chlorophenyl)piperazin-1-yl]ethanone |
|---|---|
| Flash_Point: | 227.886ºC |
| Melting_Point: | N/A |
| FW: | 253.72800 |
| Density: | 1.28g/cm3 |
| CAS: | 875576-30-0 |
| Bolling_Point: | 453.198ºC at 760 mmHg |
| MF: | C12H16ClN3O |
| Density: | 1.28g/cm3 |
|---|---|
| LogP: | 2.17480 |
| Flash_Point: | 227.886ºC |
| Refractive_Index: | 1.606 |
| FW: | 253.72800 |
| PSA: | 49.57000 |
| MF: | C12H16ClN3O |
| Bolling_Point: | 453.198ºC at 760 mmHg |
| Exact_Mass: | 253.09800 |