4-(4-BENZYLPIPERAZINO)ANILINE
Catalog No: FT-0604237
CAS No: 16154-69-1
- Chemical Name: 4-(4-BENZYLPIPERAZINO)ANILINE
- Molecular Formula: C17H21N3
- Molecular Weight: 267.37
- InChI Key: PZWVVLZWQWIEAV-UHFFFAOYSA-N
- InChI: InChI=1S/C17H21N3/c18-16-6-8-17(9-7-16)20-12-10-19(11-13-20)14-15-4-2-1-3-5-15/h1-9H,10-14,18H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 140-142ºC |
|---|---|
| CAS: | 16154-69-1 |
| MF: | C17H21N3 |
| Flash_Point: | 220.1ºC |
| Product_Name: | 4-(4-Benzylpiperazin-1-yl)phenylamine |
| Density: | 1.145g/cm3 |
| FW: | 267.36900 |
| Bolling_Point: | 446.3ºC at 760mmHg |
| Melting_Point: | 140-142ºC |
|---|---|
| Vapor_Pressure: | 3.68E-08mmHg at 25°C |
| MF: | C17H21N3 |
| Flash_Point: | 220.1ºC |
| LogP: | 3.17510 |
| FW: | 267.36900 |
| Density: | 1.145g/cm3 |
| PSA: | 32.50000 |
| Bolling_Point: | 446.3ºC at 760mmHg |
| Exact_Mass: | 267.17400 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)