N-Succinimidyl 4-(4-maleimidophenyl)butyrate
Catalog No: FT-0604065
CAS No: 79886-55-8
- Chemical Name: N-Succinimidyl 4-(4-maleimidophenyl)butyrate
- Molecular Formula: C18H16N2O6
- Molecular Weight: 356.3
- InChI Key: PMJWDPGOWBRILU-UHFFFAOYSA-N
- InChI: InChI=1S/C18H16N2O6/c21-14-8-9-15(22)19(14)13-6-4-12(5-7-13)2-1-3-18(25)26-20-16(23)10-11-17(20)24/h4-9H,1-3,10-11H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 79886-55-8 |
| Flash_Point: | 287.1±32.9 °C |
| Product_Name: | succinimidyl 4-(p-maleimidophenyl)butyrate |
| Bolling_Point: | 551.1±60.0 °C at 760 mmHg |
| FW: | 356.329 |
| Melting_Point: | 130-131ºC |
| MF: | C18H16N2O6 |
| Density: | 1.5±0.1 g/cm3 |
| Melting_Point: | 130-131ºC |
|---|---|
| Refractive_Index: | 1.637 |
| Vapor_Pressure: | 0.0±1.5 mmHg at 25°C |
| MF: | C18H16N2O6 |
| Flash_Point: | 287.1±32.9 °C |
| LogP: | -0.31 |
| FW: | 356.329 |
| Density: | 1.5±0.1 g/cm3 |
| PSA: | 101.06000 |
| Bolling_Point: | 551.1±60.0 °C at 760 mmHg |
| Exact_Mass: | 356.100830 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)