N,N-Bis(2,6-diisopropylphenyl)ethylenediamine
Catalog No: FT-0603811
CAS No: 134030-22-1
- Chemical Name: N,N-Bis(2,6-diisopropylphenyl)ethylenediamine
- Molecular Formula: C26H40N2
- Molecular Weight: 380.6
- InChI Key: RVMDHNMIJJBYQG-UHFFFAOYSA-N
- InChI: InChI=1S/C26H40N2/c1-17(2)21-11-9-12-22(18(3)4)25(21)27-15-16-28-26-23(19(5)6)13-10-14-24(26)20(7)8/h9-14,17-20,27-28H,15-16H2,1-8H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 380.609 |
| Density: | 1.0±0.1 g/cm3 |
| CAS: | 134030-22-1 |
| Bolling_Point: | 503.5±50.0 °C at 760 mmHg |
| Product_Name: | N,N'-Bis(2,6-diisopropylphenyl)-1,2-ethanediamine |
| Melting_Point: | 101-106ºC |
| Flash_Point: | 288.9±21.9 °C |
| MF: | C26H40N2 |
| Density: | 1.0±0.1 g/cm3 |
|---|---|
| LogP: | 8.13 |
| Flash_Point: | 288.9±21.9 °C |
| Melting_Point: | 101-106ºC |
| FW: | 380.609 |
| PSA: | 24.06000 |
| Exact_Mass: | 380.319153 |
| MF: | C26H40N2 |
| Bolling_Point: | 503.5±50.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.3 mmHg at 25°C |
| Refractive_Index: | 1.562 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2921590090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)