2-Oxo-(2H)-furo(2,3-h)-1-benzopyran
Catalog No: FT-0603446
CAS No: 523-50-2
- Chemical Name: 2-Oxo-(2H)-furo(2,3-h)-1-benzopyran
- Molecular Formula: C11H6O3
- Molecular Weight: 186.16
- InChI Key: XDROKJSWHURZGO-UHFFFAOYSA-N
- InChI: InChI=1S/C11H6O3/c12-10-4-2-7-1-3-9-8(5-6-13-9)11(7)14-10/h1-6H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Angelicin |
|---|---|
| Bolling_Point: | 362.6±27.0 °C at 760 mmHg |
| MF: | C11H6O3 |
| Symbol: | GHS07, GHS08 |
| Melting_Point: | 132-134ºC |
| CAS: | 523-50-2 |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 186.163 |
| Flash_Point: | 173.1±23.7 °C |
| MF: | C11H6O3 |
|---|---|
| Bolling_Point: | 362.6±27.0 °C at 760 mmHg |
| Exact_Mass: | 186.031693 |
| Melting_Point: | 132-134ºC |
| Refractive_Index: | 1.667 |
| PSA: | 43.35000 |
| Flash_Point: | 173.1±23.7 °C |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 186.163 |
| LogP: | 2.01 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Risk_Statements(EU): | R20/21/22;R36/37/38;R40 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard_Codes: | Xn:Harmful; |
| RTECS: | LV0940000 |
| HS_Code: | 2932999099 |
| Safety_Statements: | S26-S36/37/39 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Symbol: | GHS07, GHS08 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)