Cemandil sodium salt
Catalog No: FT-0603064
CAS No: 42540-40-9
- Chemical Name: Cemandil sodium salt
- Molecular Formula: C19H17N6NaO6S2
- Molecular Weight: 512.5
- InChI Key: ICZOIXFFVKYXOM-YCLOEFEOSA-M
- InChI: InChI=1S/C19H18N6O6S2.Na/c1-24-19(21-22-23-24)33-8-11-7-32-17-12(16(28)25(17)13(11)18(29)30)20-15(27)14(31-9-26)10-5-3-2-4-6-10;/h2-6,9,12,14,17H,7-8H2,1H3,(H,20,27)(H,29,30);/q;+1/p-1/t12-,14-,17-;/m1./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS08 |
|---|---|
| CAS: | 42540-40-9 |
| Flash_Point: | N/A |
| Product_Name: | Cefamandole nafate |
| Bolling_Point: | N/A |
| FW: | 512.495 |
| Melting_Point: | 190-193ºC |
| MF: | C19H17N6NaO6S2 |
| Density: | N/A |
| Melting_Point: | 190-193ºC |
|---|---|
| MF: | C19H17N6NaO6S2 |
| Exact_Mass: | 512.054871 |
| FW: | 512.495 |
| PSA: | 210.04000 |
| Symbol: | GHS07, GHS08 |
|---|---|
| Risk_Statements(EU): | 36/37/38-42/43 |
| HS_Code: | 3003201900 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn |
| Warning_Statement: | P261-P280-P284-P304 + P340-P305 + P351 + P338-P342 + P311 |
| Safety_Statements: | H315-H317-H319-H334-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)