4-Chloro-2,3-dimethylpyridine 1-oxide
Catalog No: FT-0602429
CAS No: 59886-90-7
- Molecular Formula: 157.6
- Formula Weight: C7H8ClNO
- Inchl Key: MCUYHRNUDDANSO-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H8ClNO/c1-5-6(2)9(10)4-3-7(5)8/h3-4H,1-2H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 103-105°C |
|---|---|
| CAS: | 59886-90-7 |
| MF: | C7H8ClNO |
| Flash_Point: | 158.5±26.5 °C |
| Product_Name: | 4-Chloro-2,3-dimethylpyridine 1-oxide |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 157.598 |
| Bolling_Point: | 338.5±37.0 °C at 760 mmHg |
| Refractive_Index: | 1.537 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Flash_Point: | 158.5±26.5 °C |
| LogP: | 0.48 |
| Bolling_Point: | 338.5±37.0 °C at 760 mmHg |
| FW: | 157.598 |
| PSA: | 25.46000 |
| Computational_Chemistry: | ['1. XlogP :13 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :N/A ', '6. TPSA 255 ', '7. Heavy Atom Count :10 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :120 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 103-105°C |
| MF: | C7H8ClNO |
| Exact_Mass: | 157.029449 |
| Molecular_Structure: | ['1 . Molar refractive index 4129 ', '2 . Molar volume 1321 ', '3 . Parachor （902K）3234 ', '4 . Surface tension 358 ', '5 . Polarizability 1636'] |
| Density: | 1.2±0.1 g/cm3 |
| More_Info: | ['1 . Melting point（ºC）103~105 ', '2. Flash point（ºC）1585 ', '3. Density119'] |
| Hazard_Class: | 3 |
|---|---|
| Risk_Statements(EU): | R10:Flammable. R22:Harmful if swallowed. R41:Risk of serious damage to eyes. |
| WGK_Germany: | 3 |
| RTECS: | LU5187000 |
| RIDADR: | UN 1993 3/PG 3 |
| Hazard_Codes: | Xn |
| HS_Code: | 2942000000 |
| Safety_Statements: | S16-S26-S39-S36/37-S23 |
| Packing_Group: | III |
