4-bromoquinoline
Catalog No: FT-0602277
CAS No: 3964-04-3
- Chemical Name: 4-bromoquinoline
- Molecular Formula: C9H6BrN
- Molecular Weight: 208.05
- InChI Key: SUXIPCHEUMEUSV-UHFFFAOYSA-N
- InChI: InChI=1S/C9H6BrN/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 3964-04-3 |
| Flash_Point: | 132.8±19.8 °C |
| Product_Name: | 4-Bromoquinoline |
| Bolling_Point: | 295.9±13.0 °C at 760 mmHg |
| FW: | 208.055 |
| Melting_Point: | 29-34ºC |
| MF: | C9H6BrN |
| Density: | 1.6±0.1 g/cm3 |
| Melting_Point: | 29-34ºC |
|---|---|
| Refractive_Index: | 1.674 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| MF: | C9H6BrN |
| Flash_Point: | 132.8±19.8 °C |
| LogP: | 2.76 |
| FW: | 208.055 |
| Density: | 1.6±0.1 g/cm3 |
| PSA: | 12.89000 |
| Bolling_Point: | 295.9±13.0 °C at 760 mmHg |
| Exact_Mass: | 206.968353 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933499090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)