![4-[(Phenylsulfanyl)methyl]aniline (CAS: 13738-70-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0602242.png "4-[(Phenylsulfanyl)methyl]aniline chemical structure")
4-[(Phenylsulfanyl)methyl]aniline
Catalog No: FT-0602242
CAS No: 13738-70-0
- Chemical Name: 4-[(Phenylsulfanyl)methyl]aniline
- Molecular Formula: C13H13NS
- Molecular Weight: 215.32
- InChI Key: BETHGEVRYKIURN-UHFFFAOYSA-N
- InChI: InChI=1S/C13H13NS/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13/h1-9H,10,14H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 73-75ºC |
|---|---|
| CAS: | 13738-70-0 |
| MF: | C13H13NS |
| Flash_Point: | 183ºC |
| Product_Name: | 4-(phenylsulfanylmethyl)aniline |
| Density: | 1.16g/cm3 |
| FW: | 215.31400 |
| Bolling_Point: | 378.9ºC at 760mmHg |
| Melting_Point: | 73-75ºC |
|---|---|
| Refractive_Index: | 1.656 |
| Vapor_Pressure: | 6.07E-06mmHg at 25°C |
| MF: | C13H13NS |
| Flash_Point: | 183ºC |
| LogP: | 4.14230 |
| FW: | 215.31400 |
| Density: | 1.16g/cm3 |
| PSA: | 51.32000 |
| Bolling_Point: | 378.9ºC at 760mmHg |
| Exact_Mass: | 215.07700 |
| HS_Code: | 2930909090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)