2-(4-Hydroxyphenyl)-5-pyrimidinol
Catalog No: FT-0601855
CAS No: 142172-97-2
- Chemical Name: 2-(4-Hydroxyphenyl)-5-pyrimidinol
- Molecular Formula: C10H8N2O2
- Molecular Weight: 188.18
- InChI Key: BKOPBDRWHKDPPN-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8N2O2/c13-8-3-1-7(2-4-8)10-11-5-9(14)6-12-10/h1-6,13-14H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 188.18300 |
| Density: | 1.363 g/cm3 |
| CAS: | 142172-97-2 |
| Bolling_Point: | 295.9ºC at 760 mmHg |
| Product_Name: | 4-(5-hydroxy-1H-pyrimidin-2-ylidene)cyclohexa-2,5-dien-1-one |
| Melting_Point: | 235-240ºC(lit.) |
| Flash_Point: | 132.8ºC |
| MF: | C10H8N2O2 |
| Density: | 1.363 g/cm3 |
|---|---|
| LogP: | 1.55480 |
| Flash_Point: | 132.8ºC |
| Melting_Point: | 235-240ºC(lit.) |
| FW: | 188.18300 |
| PSA: | 66.24000 |
| Exact_Mass: | 188.05900 |
| MF: | C10H8N2O2 |
| Bolling_Point: | 295.9ºC at 760 mmHg |
| Vapor_Pressure: | 8.26E-06mmHg at 25°C |
| Refractive_Index: | 1.651 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-37/39 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)