1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde
Catalog No: FT-0601832
CAS No: 4649-09-6
- Chemical Name: 1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde
- Molecular Formula: C8H6N2O
- Molecular Weight: 146.15
- InChI Key: KAIWRKYDYWYFIT-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6N2O/c11-5-6-4-10-8-7(6)2-1-3-9-8/h1-5H,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 146.146 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 4649-09-6 |
| Bolling_Point: | 361.1±22.0 °C at 760 mmHg |
| Product_Name: | 7-Azaindole-3-carboxaldehyde |
| Melting_Point: | 216-220ºC |
| Flash_Point: | 176.0±28.8 °C |
| MF: | C8H6N2O |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 1.21 |
| Flash_Point: | 176.0±28.8 °C |
| Melting_Point: | 216-220ºC |
| FW: | 146.146 |
| PSA: | 45.75000 |
| Exact_Mass: | 146.048019 |
| MF: | C8H6N2O |
| Bolling_Point: | 361.1±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Refractive_Index: | 1.747 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | 26-36/37 |
| Symbol: | Warning |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)