(S)-4,5,6,7-Tetrahydro-2,6-benzothiazolediamine
Catalog No: FT-0601674
CAS No: 106092-09-5
- Molecular Formula: 169.25
- Formula Weight: C7H11N3S
- Inchl Key: DRRYZHHKWSHHFT-BYPYZUCNSA-N
- Inchl: InChI=1S/C7H11N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h4H,1-3,8H2,(H2,9,10)/t4-/m0/s1
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 169.247 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 106092-09-5 |
| Bolling_Point: | 359.0±42.0 °C at 760 mmHg |
| Product_Name: | (S)-4,5,6,7-Tetrahydro-2,6-benzothiazolediamine |
| Melting_Point: | 222-224ºC |
| Flash_Point: | 170.9±27.9 °C |
| MF: | C7H11N3S |
| LogP: | 0.25 |
|---|---|
| Flash_Point: | 170.9±27.9 °C |
| Refractive_Index: | 1.656 |
| FW: | 169.247 |
| Bolling_Point: | 359.0±42.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 222-224ºC |
| PSA: | 92.31000 |
| Exact_Mass: | 169.067368 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| MF: | C7H11N3S |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934200090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)