2,4-Dimethoxy-1-fluorobenzene
Catalog No: FT-0600857
CAS No: 17715-70-7
- Chemical Name: 2,4-Dimethoxy-1-fluorobenzene
- Molecular Formula: C8H9FO2
- Molecular Weight: 156.15
- InChI Key: QLJNEPOEZGFNEA-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9FO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 156.154 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 17715-70-7 |
| Bolling_Point: | 221.2±20.0 °C at 760 mmHg |
| Product_Name: | 1-Fluoro-2,4-dimethoxybenzene |
| Melting_Point: | N/A |
| Flash_Point: | 94.3±17.7 °C |
| MF: | C8H9FO2 |
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| LogP: | 2.01 |
| Flash_Point: | 94.3±17.7 °C |
| Refractive_Index: | 1.471 |
| FW: | 156.154 |
| PSA: | 18.46000 |
| MF: | C8H9FO2 |
| Bolling_Point: | 221.2±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.2±0.4 mmHg at 25°C |
| Exact_Mass: | 156.058655 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2909309090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)