2-Chloro-6-nitro-3-phenoxy-aniline
Catalog No: FT-0600291
CAS No: 74070-46-5
- Chemical Name: 2-Chloro-6-nitro-3-phenoxy-aniline
- Molecular Formula: C12H9ClN2O3
- Molecular Weight: 264.66
- InChI Key: DDBMQDADIHOWIC-UHFFFAOYSA-N
- InChI: InChI=1S/C12H9ClN2O3/c13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17/h1-7H,14H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 264.66400 |
| Density: | 1.422g/cm3 |
| CAS: | 74070-46-5 |
| Bolling_Point: | 400ºC (e) |
| Product_Name: | aclonifen |
| Melting_Point: | 81ºC |
| Flash_Point: | 172.4ºC |
| MF: | C12H9ClN2O3 |
| Density: | 1.422g/cm3 |
|---|---|
| LogP: | 4.72710 |
| Flash_Point: | 172.4ºC |
| Melting_Point: | 81ºC |
| FW: | 264.66400 |
| PSA: | 81.07000 |
| Exact_Mass: | 264.03000 |
| MF: | C12H9ClN2O3 |
| Bolling_Point: | 400ºC (e) |
| Refractive_Index: | 1.656 |
| Personal_Protective_Equipment: | Eyeshields;Gloves |
|---|---|
| RTECS: | CX9858650 |
| Risk_Statements(EU): | R50/53 |
| Safety_Statements: | H410 |
| Symbol: | Warning |
| Warning_Statement: | P273-P501 |
| RIDADR: | UN3077 9/PG 3 |
| Hazard_Codes: | N: Dangerous for the environment; |
| HS_Code: | 2921420013 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)