2,4-Diphenyl-1,3-cyclobutanedicarboxylic acid
Catalog No: FT-0600226
CAS No: 4462-95-7
- Chemical Name: 2,4-Diphenyl-1,3-cyclobutanedicarboxylic acid
- Molecular Formula: C18H16O4
- Molecular Weight: 296.3
- InChI Key: QWFRRFLKWRIKSZ-UHFFFAOYSA-N
- InChI: InChI=1S/C18H16O4/c19-17(20)15-13(11-7-3-1-4-8-11)16(18(21)22)14(15)12-9-5-2-6-10-12/h1-10,13-16H,(H,19,20)(H,21,22)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2,4-Diphenyl-1,3-cyclobutanedicarboxylic acid |
|---|---|
| Flash_Point: | 252.4ºC |
| Melting_Point: | N/A |
| FW: | 296.31700 |
| Density: | 1.323 g/cm3 |
| CAS: | 4462-95-7 |
| Bolling_Point: | 470.5ºC at 760mmHg |
| MF: | C18H16O4 |
| Density: | 1.323 g/cm3 |
|---|---|
| LogP: | 2.96920 |
| Flash_Point: | 252.4ºC |
| Refractive_Index: | 1.629 |
| FW: | 296.31700 |
| PSA: | 74.60000 |
| MF: | C18H16O4 |
| Bolling_Point: | 470.5ºC at 760mmHg |
| Exact_Mass: | 296.10500 |
| HS_Code: | 2917399090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)