3-Bromo-4-fluoropyridine
Catalog No: FT-0600161
CAS No: 116922-60-2
- Chemical Name: 3-Bromo-4-fluoropyridine
- Molecular Formula: C5H3BrFN
- Molecular Weight: 175.99
- InChI Key: PKYADCLPLQPPKK-UHFFFAOYSA-N
- InChI: InChI=1S/C5H3BrFN/c6-4-3-8-2-1-5(4)7/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 175.986 |
| Density: | 1.7±0.1 g/cm3 |
| CAS: | 116922-60-2 |
| Bolling_Point: | 168.8±20.0 °C at 760 mmHg |
| Product_Name: | 3-Bromo-4-fluoropyridine |
| Melting_Point: | N/A |
| Flash_Point: | 55.9±21.8 °C |
| MF: | C5H3BrFN |
| Density: | 1.7±0.1 g/cm3 |
|---|---|
| LogP: | 1.62 |
| Flash_Point: | 55.9±21.8 °C |
| Refractive_Index: | 1.534 |
| FW: | 175.986 |
| PSA: | 12.89000 |
| MF: | C5H3BrFN |
| Bolling_Point: | 168.8±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 2.1±0.3 mmHg at 25°C |
| Exact_Mass: | 174.943283 |
| Symbol: | GHS07 |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319 |
| HS_Code: | 2933399090 |
Related Products
methyl 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate
Benzofuran,polymer with ethenylbenzene and (1-methylethenyl)benzene (9CI)
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridin-3-ylacetic acid