Methyl 4-chloropyridine-2-carboxylate
Catalog No: FT-0600152
CAS No: 24484-93-3
- Chemical Name: Methyl 4-chloropyridine-2-carboxylate
- Molecular Formula: C7H6ClNO2
- Molecular Weight: 171.58
- InChI Key: VTENWIPSWAMPKI-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6ClNO2/c1-11-7(10)6-4-5(8)2-3-9-6/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 171.581 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 24484-93-3 |
| Bolling_Point: | 264.0±20.0 °C at 760 mmHg |
| Product_Name: | Methyl 4-chloropicolinate |
| Melting_Point: | 54-56ºC |
| Flash_Point: | 113.4±21.8 °C |
| MF: | C7H6ClNO2 |
| LogP: | 1.01 |
|---|---|
| Flash_Point: | 113.4±21.8 °C |
| Refractive_Index: | 1.531 |
| FW: | 171.581 |
| Bolling_Point: | 264.0±20.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 54-56ºC |
| PSA: | 39.19000 |
| Exact_Mass: | 171.008713 |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| MF: | C7H6ClNO2 |
| Hazard_Codes: | Xn: Harmful; |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)