2-Bromo-isonicotinic acid methyl ester
Catalog No: FT-0600146
CAS No: 26156-48-9
- Chemical Name: 2-Bromo-isonicotinic acid methyl ester
- Molecular Formula: C7H6BrNO2
- Molecular Weight: 216.03
- InChI Key: MULLTHQTADMZDM-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6BrNO2/c1-11-7(10)5-2-3-9-6(8)4-5/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 26156-48-9 |
| Flash_Point: | 115.9±21.8 °C |
| Product_Name: | Methyl 2-bromoisonicotinate |
| Bolling_Point: | 268.0±20.0 °C at 760 mmHg |
| FW: | 216.032 |
| Melting_Point: | 35-36ºC |
| MF: | C7H6BrNO2 |
| Density: | 1.6±0.1 g/cm3 |
| Melting_Point: | 35-36ºC |
|---|---|
| Refractive_Index: | 1.554 |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| MF: | C7H6BrNO2 |
| Flash_Point: | 115.9±21.8 °C |
| LogP: | 1.60 |
| FW: | 216.032 |
| Density: | 1.6±0.1 g/cm3 |
| PSA: | 39.19000 |
| Bolling_Point: | 268.0±20.0 °C at 760 mmHg |
| Exact_Mass: | 214.958176 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933399090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)