2,5-Dimethyl-1,3-oxazole-4-carbonyl chloride
Catalog No: FT-0600134
CAS No: 197719-27-0
- Chemical Name: 2,5-Dimethyl-1,3-oxazole-4-carbonyl chloride
- Molecular Formula: C6H6ClNO2
- Molecular Weight: 159.57
- InChI Key: XZXCVPKMCPXVFF-UHFFFAOYSA-N
- InChI: InChI=1S/C6H6ClNO2/c1-3-5(6(7)9)8-4(2)10-3/h1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2,5-dimethyl-1,3-oxazole-4-carbonyl chloride |
|---|---|
| Flash_Point: | 79.9ºC |
| Melting_Point: | 217ºC |
| FW: | 159.57000 |
| Density: | 1.282g/cm3 |
| CAS: | 197719-27-0 |
| Bolling_Point: | 208.5ºC at 760mmHg |
| MF: | C6H6ClNO2 |
| Density: | 1.282g/cm3 |
|---|---|
| LogP: | 1.67040 |
| Flash_Point: | 79.9ºC |
| Melting_Point: | 217ºC |
| FW: | 159.57000 |
| PSA: | 43.10000 |
| Exact_Mass: | 159.00900 |
| MF: | C6H6ClNO2 |
| Bolling_Point: | 208.5ºC at 760mmHg |
| Vapor_Pressure: | 0.213mmHg at 25°C |
| Refractive_Index: | 1.499 |
| Hazard_Codes: | C: Corrosive; |
|---|---|
| RIDADR: | UN 3261 |
| Risk_Statements(EU): | R34 |
| HS_Code: | 2934999090 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)