![4'-Nitro-[1,1'-biphenyl]-4-carboxaldehyde (CAS: 98648-23-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0617964.png "4'-Nitro-[1,1'-biphenyl]-4-carboxaldehyde chemical structure")
4'-Nitro-[1,1'-biphenyl]-4-carboxaldehyde
Catalog No: FT-0617964
CAS No: 98648-23-8
- Chemical Name: 4'-Nitro-[1,1'-biphenyl]-4-carboxaldehyde
- Molecular Formula: C13H9NO3
- Molecular Weight: 227.21
- InChI Key: MGHIIGWDUVNPPV-UHFFFAOYSA-N
- InChI: InChI=1S/C13H9NO3/c15-9-10-1-3-11(4-2-10)12-5-7-13(8-6-12)14(16)17/h1-9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 227.21500 |
|---|---|
| CAS: | 98648-23-8 |
| Melting_Point: | 117-120ºC |
| Bolling_Point: | 404.9ºC at 760 mmHg |
| MF: | C13H9NO3 |
| Product_Name: | 4-(4-nitrophenyl)benzaldehyde |
| Flash_Point: | 200.6ºC |
| Density: | 1.274g/cm3 |
| FW: | 227.21500 |
|---|---|
| MF: | C13H9NO3 |
| Exact_Mass: | 227.05800 |
| Flash_Point: | 200.6ºC |
| LogP: | 3.59750 |
| PSA: | 62.89000 |
| Refractive_Index: | 1.639 |
| Bolling_Point: | 404.9ºC at 760 mmHg |
| Melting_Point: | 117-120ºC |
| Density: | 1.274g/cm3 |
| Hazard_Codes: | Xi |
|---|---|
| HS_Code: | 2913000090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)