(R)-5-BROMOMETHYL-2-PYRROLIDINONE
Catalog No: FT-0659291
CAS No: 98612-60-3
- Chemical Name: (R)-5-BROMOMETHYL-2-PYRROLIDINONE
- Molecular Formula: C5H8BrNO
- Molecular Weight: 178.03
- InChI Key: QFOSFXPTXNRRMF-SCSAIBSYSA-N
- InChI: InChI=1S/C5H8BrNO/c6-3-4-1-2-5(8)7-4/h4H,1-3H2,(H,7,8)/t4-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 178.027 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 98612-60-3 |
| Bolling_Point: | 336.1±15.0 °C at 760 mmHg |
| Product_Name: | (5R)-5-(Brommethyl)pyrrolidin-2-on |
| Melting_Point: | 67-69ºC |
| Flash_Point: | 157.1±20.4 °C |
| MF: | C5H8BrNO |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | -0.77 |
| Flash_Point: | 157.1±20.4 °C |
| Melting_Point: | 67-69ºC |
| FW: | 178.027 |
| PSA: | 29.10000 |
| Exact_Mass: | 176.978912 |
| MF: | C5H8BrNO |
| Bolling_Point: | 336.1±15.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Refractive_Index: | 1.507 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H317-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933790090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)