6-Methoxy-pyridine-2-carboxylic acid amide
Catalog No: FT-0678104
CAS No: 98276-69-8
- Chemical Name: 6-Methoxy-pyridine-2-carboxylic acid amide
- Molecular Formula: C7H8N2O2
- Molecular Weight: 152.15
- InChI Key: FYSOQIKOUXQYSU-UHFFFAOYSA-N
- InChI: InChI=1S/C7H8N2O2/c1-11-6-4-2-3-5(9-6)7(8)10/h2-4H,1H3,(H2,8,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 152.15100 |
| Density: | 1.213g/cm3 |
| CAS: | 98276-69-8 |
| Bolling_Point: | 285ºC at 760mmHg |
| Product_Name: | 6-methoxypyridine-2-carboxamide |
| Melting_Point: | 108-109ºC |
| Flash_Point: | 126.2ºC |
| MF: | C7H8N2O2 |
| Density: | 1.213g/cm3 |
|---|---|
| LogP: | 0.88940 |
| Flash_Point: | 126.2ºC |
| Melting_Point: | 108-109ºC |
| FW: | 152.15100 |
| PSA: | 65.21000 |
| Exact_Mass: | 152.05900 |
| MF: | C7H8N2O2 |
| Bolling_Point: | 285ºC at 760mmHg |
| Refractive_Index: | 1.55 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)