Chloramphenicol sodium succinate
Catalog No: FT-0602993
CAS No: 982-57-0
- Chemical Name: Chloramphenicol sodium succinate
- Molecular Formula: C15H15Cl2N2NaO8
- Molecular Weight: 445.2
- InChI Key: RPLOPBHEZLFENN-HTMVYDOJSA-M
- InChI: InChI=1S/C15H16Cl2N2O8.Na/c16-14(17)15(24)18-10(7-27-12(22)6-5-11(20)21)13(23)8-1-3-9(4-2-8)19(25)26;/h1-4,10,13-14,23H,5-7H2,(H,18,24)(H,20,21);/q;+1/p-1/t10-,13-;/m1./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS08 |
|---|---|
| CAS: | 982-57-0 |
| Flash_Point: | 387ºC |
| Product_Name: | Chloramphenicol sodium succinate |
| Bolling_Point: | 716.3ºC at 760mmHg |
| FW: | 445.184 |
| Melting_Point: | N/A |
| MF: | C15H15Cl2N2NaO8 |
| Density: | N/A |
| MF: | C15H15Cl2N2NaO8 |
|---|---|
| Flash_Point: | 387ºC |
| LogP: | 0.90410 |
| Bolling_Point: | 716.3ºC at 760mmHg |
| FW: | 445.184 |
| PSA: | 161.58000 |
| Exact_Mass: | 444.010315 |
| Symbol: | GHS08 |
|---|---|
| Risk_Statements(EU): | R40 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RTECS: | AB6905000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P280 |
| Safety_Statements: | H351 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)