cyclopropanecarbonitrile, 1-(2-fluorophenyl)-
Catalog No: FT-0693187
CAS No: 97009-38-6
- Chemical Name: cyclopropanecarbonitrile, 1-(2-fluorophenyl)-
- Molecular Formula: C10H8FN
- Molecular Weight: 161.18
- InChI Key: RAAFWJWXKWFSJX-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8FN/c11-9-4-2-1-3-8(9)10(7-12)5-6-10/h1-4H,5-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-(2-Fluorophenyl)cyclopropanecarbonitrile |
|---|---|
| Flash_Point: | 115.8±29.1 °C |
| Melting_Point: | N/A |
| FW: | 161.176 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 97009-38-6 |
| Bolling_Point: | 276.5±33.0 °C at 760 mmHg |
| MF: | C10H8FN |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.59 |
| Flash_Point: | 115.8±29.1 °C |
| Refractive_Index: | 1.549 |
| FW: | 161.176 |
| PSA: | 23.79000 |
| MF: | C10H8FN |
| Bolling_Point: | 276.5±33.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 161.064072 |
| HS_Code: | 2926909090 |
|---|
Related Products
Carbamic acid, (5-methylpyrazinyl)-, 1,1-dimethylethyl ester (9CI)
Carbonic dichloride,polymer with 4,4-(1-methylethylidene)bis2,6-dibromophenol and 4,4-(1-methylethylidene)bisphenol