![7-Bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine (CAS: 95897-49-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0681925.png "7-Bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine chemical structure")
7-Bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine
Catalog No: FT-0681925
CAS No: 95897-49-7
- Chemical Name: 7-Bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine
- Molecular Formula: C7H6BrNO2
- Molecular Weight: 216.03
- InChI Key: PMNCDNRJLYPTDB-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6BrNO2/c8-5-3-6-7(9-4-5)11-2-1-10-6/h3-4H,1-2H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 7-Bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine |
|---|---|
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| FW: | 216.03200 |
| Density: | N/A |
| CAS: | 95897-49-7 |
| Bolling_Point: | N/A |
| MF: | C7H6BrNO2 |
| LogP: | 1.61530 |
|---|---|
| PSA: | 31.35000 |
| MF: | C7H6BrNO2 |
| FW: | 216.03200 |
| Exact_Mass: | 214.95800 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2934999090 |
