3-Iodo-4-methoxy-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0678184
CAS No: 928653-75-2
- Chemical Name: 3-Iodo-4-methoxy-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C8H7IN2O
- Molecular Weight: 274.06
- InChI Key: PGVRYUWFBSFOBO-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7IN2O/c1-12-6-2-3-10-8-7(6)5(9)4-11-8/h2-4H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 274.059 |
| Density: | 1.9±0.1 g/cm3 |
| CAS: | 928653-75-2 |
| Bolling_Point: | 355.9±37.0 °C at 760 mmHg |
| Product_Name: | 3-iodo-4-methoxy-1H-pyrrolo[2,3-b]pyridine |
| Melting_Point: | 220-221ºC |
| Flash_Point: | 169.0±26.5 °C |
| MF: | C8H7IN2O |
| Density: | 1.9±0.1 g/cm3 |
|---|---|
| LogP: | 3.09 |
| Flash_Point: | 169.0±26.5 °C |
| Melting_Point: | 220-221ºC |
| FW: | 274.059 |
| PSA: | 37.91000 |
| Exact_Mass: | 273.960297 |
| MF: | C8H7IN2O |
| Bolling_Point: | 355.9±37.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Refractive_Index: | 1.728 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)